Products 78541-97-6
CAS 78541-97-6 is the registry number for Piquindone. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 250mg, 10mg, 25mg, 50mg, Get quote.
(4aS,8aS)-3-ethyl-2,6-dimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one (CAS 78541-97-6) is a chemical compound with the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. IUPAC name: (4aS,8aS)-3-ethyl-2,6-dimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one. InChIKey: PVZMYDPRVUCJKV-CMPLNLGQSA-N.
| Molecular formula | C15H22N2O |
|---|---|
| Molecular weight | 246.35 g/mol |
| IUPAC name | (4aS,8aS)-3-ethyl-2,6-dimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one |
| InChIKey | PVZMYDPRVUCJKV-CMPLNLGQSA-N |
| SMILES | CCC1=C(NC2=C1C(=O)[C@@H]3CN(CC[C@H]3C2)C)C |
Computed by PubChem (NCBI)