CAS 78543-06-3 appears in our catalog under these names: Flurbiprofen Impurity I, Flurbiprofen Impurity 25, 1,3-Diethyl 2-(3-fluoro-4-nitrophenyl)-2-methylpropanedioate. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25mg, 100mg, 500mg, 1g, 5g.
Diethyl 2-(3-fluoro-4-nitrophenyl)-2-methylpropanedioate (CAS 78543-06-3) is a chemical compound with the molecular formula C14H16FNO6 and a molecular weight of 313.28 g/mol. IUPAC name: diethyl 2-(3-fluoro-4-nitrophenyl)-2-methylpropanedioate. InChIKey: VHMVOAWAZZEEPH-UHFFFAOYSA-N.
| Molecular formula | C14H16FNO6 |
|---|---|
| Molecular weight | 313.28 g/mol |
| IUPAC name | diethyl 2-(3-fluoro-4-nitrophenyl)-2-methylpropanedioate |
| InChIKey | VHMVOAWAZZEEPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C1=CC(=C(C=C1)[N+](=O)[O-])F)C(=O)OCC |
Computed by PubChem (NCBI)