Products 78564-87-1
CAS 78564-87-1 is the registry number for Disperse Red 153. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-[(6,7-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-ethylanilino]propanenitrile (CAS 78564-87-1) is a chemical compound with the molecular formula C18H15Cl2N5S and a molecular weight of 404.3 g/mol. IUPAC name: 3-[4-[(6,7-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-ethylanilino]propanenitrile. InChIKey: WFRRWBDTRFNKAW-UHFFFAOYSA-N.
| Molecular formula | C18H15Cl2N5S |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | 3-[4-[(6,7-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-ethylanilino]propanenitrile |
| InChIKey | WFRRWBDTRFNKAW-UHFFFAOYSA-N |
| SMILES | CCN(CCC#N)C1=CC=C(C=C1)N=NC2=NC3=C(S2)C(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)