CAS 785707-73-5 is the registry number for N-(4-Cyanophenyl)-6-benzothiazolecarboxamide. Offered by: TRC. Available pack sizes: 25mg.
N-(4-cyanophenyl)-1,3-benzothiazole-6-carboxamide (CAS 785707-73-5) is a chemical compound with the molecular formula C15H9N3OS and a molecular weight of 279.3 g/mol. IUPAC name: N-(4-cyanophenyl)-1,3-benzothiazole-6-carboxamide. InChIKey: GJABMIUOOWUERB-UHFFFAOYSA-N.
| Molecular formula | C15H9N3OS |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | N-(4-cyanophenyl)-1,3-benzothiazole-6-carboxamide |
| InChIKey | GJABMIUOOWUERB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)NC(=O)C2=CC3=C(C=C2)N=CS3 |
Computed by PubChem (NCBI)