CAS 785792-29-2 appears in our catalog under these names: 2-(Chloromethyl)-1-ethyl-5-(morpholin-4-ylsulfonyl)-1h-benzimidazole, 95%, 2-(Chloromethyl)-1-ethyl-5-(morpholine-4-sulfonyl)-1H-1,3-benzodiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-[2-(chloromethyl)-1-ethylbenzimidazol-5-yl]sulfonylmorpholine (CAS 785792-29-2) is a chemical compound with the molecular formula C14H18ClN3O3S and a molecular weight of 343.8 g/mol. IUPAC name: 4-[2-(chloromethyl)-1-ethylbenzimidazol-5-yl]sulfonylmorpholine. InChIKey: NYHTVVUCHJDWKV-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN3O3S |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 4-[2-(chloromethyl)-1-ethylbenzimidazol-5-yl]sulfonylmorpholine |
| InChIKey | NYHTVVUCHJDWKV-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)S(=O)(=O)N3CCOCC3)N=C1CCl |
Computed by PubChem (NCBI)