Products 785792-30-5

CAS 785792-30-5 is the registry number for 3-(5-[(Diethylamino)sulfonyl]-1-propyl-1h-benzimidazol-2-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-[5-(diethylsulfamoyl)-1-propylbenzimidazol-2-yl]propanoic acid (CAS 785792-30-5) is a chemical compound with the molecular formula C17H25N3O4S and a molecular weight of 367.5 g/mol. IUPAC name: 3-[5-(diethylsulfamoyl)-1-propylbenzimidazol-2-yl]propanoic acid. InChIKey: HHMXSGCIGPVEPE-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25N3O4S
Molecular weight367.5 g/mol
IUPAC name3-[5-(diethylsulfamoyl)-1-propylbenzimidazol-2-yl]propanoic acid
InChIKeyHHMXSGCIGPVEPE-UHFFFAOYSA-N
SMILESCCCN1C2=C(C=C(C=C2)S(=O)(=O)N(CC)CC)N=C1CCC(=O)O

Computed by PubChem (NCBI)