CAS 785799-20-4 is the registry number for 5-Bromo-N-(5-methylthiazol-2-yl)nicotinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide (CAS 785799-20-4) is a chemical compound with the molecular formula C10H8BrN3OS and a molecular weight of 298.16 g/mol. IUPAC name: 5-bromo-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide. InChIKey: GWESAPTWCOFBIO-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3OS |
|---|---|
| Molecular weight | 298.16 g/mol |
| IUPAC name | 5-bromo-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide |
| InChIKey | GWESAPTWCOFBIO-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)NC(=O)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)