CAS 78662-58-5 is the registry number for 1-Cyano-1-methylethyl b-D-glucopyranosiduronic acid. Offered by: Biosynth. Available pack sizes: 5mg, 1mg, 10mg.
(2S,3S,4S,5R,6S)-6-(2-cyanopropan-2-yloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 78662-58-5) is a chemical compound with the molecular formula C10H15NO7 and a molecular weight of 261.23 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-(2-cyanopropan-2-yloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: IYYGQQFMSVUKPL-MNDKRXPHSA-N.
| Molecular formula | C10H15NO7 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-(2-cyanopropan-2-yloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | IYYGQQFMSVUKPL-MNDKRXPHSA-N |
| SMILES | CC(C)(C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O)O)O |
Computed by PubChem (NCBI)