CAS 786701-13-1 appears in our catalog under these names: Emicerfont (GW876008), Emicerfont, 98%, Emicerfont, 98.03%, 98.03%, Emicerfont, 98.03%. Offered by: GLPBio, AmBeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 100mg, 10mg, 5mg, 25 mg, 50 mg, 10 mg, 5 mg.
1-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]imidazolidin-2-one (CAS 786701-13-1) is a chemical compound with the molecular formula C22H24N6O2 and a molecular weight of 404.5 g/mol. IUPAC name: 1-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]imidazolidin-2-one. InChIKey: JFHJGXQFESYQGY-UHFFFAOYSA-N.
| Molecular formula | C22H24N6O2 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | 1-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]imidazolidin-2-one |
| InChIKey | JFHJGXQFESYQGY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2CCN(C2=N1)C3=C(C=C(C=C3)OC)C)N4C=CC(=N4)N5CCNC5=O |
Computed by PubChem (NCBI)