Products 78742-93-5

CAS 78742-93-5 is the registry number for 3-Methyl-2-furoic Acid-d (Contained d0), >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.

Structural formula: {0} (CAS {1})

5-deuterio-3-methylfuran-2-carboxylic acid (CAS 78742-93-5) is a chemical compound with the molecular formula C6H6O3 and a molecular weight of 127.12 g/mol. IUPAC name: 5-deuterio-3-methylfuran-2-carboxylic acid. InChIKey: BNYIQEFWGSXIKQ-WFVSFCRTSA-N.

Identity
Molecular formulaC6H6O3
Molecular weight127.12 g/mol
IUPAC name5-deuterio-3-methylfuran-2-carboxylic acid
InChIKeyBNYIQEFWGSXIKQ-WFVSFCRTSA-N
SMILES[2H]C1=CC(=C(O1)C(=O)O)C

Computed by PubChem (NCBI)