CAS 78744-33-9 is the registry number for 6-Chloro-5-(methylsulfonyl)pyrimidine-2,4-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-5-methylsulfonylpyrimidine-2,4-diamine (CAS 78744-33-9) is a chemical compound with the molecular formula C5H7ClN4O2S and a molecular weight of 222.65 g/mol. IUPAC name: 6-chloro-5-methylsulfonylpyrimidine-2,4-diamine. InChIKey: RJTOPORKJBWXQW-UHFFFAOYSA-N.
| Molecular formula | C5H7ClN4O2S |
|---|---|
| Molecular weight | 222.65 g/mol |
| IUPAC name | 6-chloro-5-methylsulfonylpyrimidine-2,4-diamine |
| InChIKey | RJTOPORKJBWXQW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(N=C(N=C1Cl)N)N |
Computed by PubChem (NCBI)