CAS 78755-80-3 appears in our catalog under these names: 7-Fluoro-3,4-dihydro-4-methyl-1h-1,4-benzodiazepine-2,5-dione, 95%, Flumazenil EP Impurity D, 7-Fluoro-3,4-dihydro-4-methyl-1H-1,4-benzodiazepine-2,5-dione, >95% (HPLC), 7–Fluoro–4–methyl–3,4–dihydro–1H–benzo(e)(1,4)diazepine–2,5–dione, 7-Fluoro-4-methyl-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione 97%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 1g, 250mg, on request, 100mg, 10mg, 25mg, 5g.
7-fluoro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione (CAS 78755-80-3) is a chemical compound with the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. IUPAC name: 7-fluoro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione. InChIKey: BKHGZIQXTHAVNJ-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O2 |
|---|---|
| Molecular weight | 208.19 g/mol |
| IUPAC name | 7-fluoro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| InChIKey | BKHGZIQXTHAVNJ-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC2=C(C1=O)C=C(C=C2)F |
Computed by PubChem (NCBI)