CAS 787552-38-9 appears in our catalog under these names: 1,3-Di-tert-butyl-1h-pyrazol-5-amine, 95%, 1,3–Di–tert–butyl–1H–pyrazol–5–amine, 1,3-di-tert-butyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
1,3-ditert-butylpyrazol-5-amine (CAS 787552-38-9) is a chemical compound with the molecular formula C11H21N3 and a molecular weight of 195.30 g/mol. IUPAC name: 1,3-ditert-butylpyrazol-5-amine. InChIKey: CQCGLMBJVRDWGL-UHFFFAOYSA-N.
| Molecular formula | C11H21N3 |
|---|---|
| Molecular weight | 195.30 g/mol |
| IUPAC name | 1,3-ditert-butylpyrazol-5-amine |
| InChIKey | CQCGLMBJVRDWGL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C(C)(C)C |
Computed by PubChem (NCBI)