Products 787581-28-6

CAS 787581-28-6 is the registry number for 3-(((2-(Trimethylsilyl)ethoxy)carbonyl)amino)propanoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(2-trimethylsilylethoxycarbonylamino)propanoic acid (CAS 787581-28-6) is a chemical compound with the molecular formula C9H19NO4Si and a molecular weight of 233.34 g/mol. IUPAC name: 3-(2-trimethylsilylethoxycarbonylamino)propanoic acid. InChIKey: AWPCWOALJPNHRF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19NO4Si
Molecular weight233.34 g/mol
IUPAC name3-(2-trimethylsilylethoxycarbonylamino)propanoic acid
InChIKeyAWPCWOALJPNHRF-UHFFFAOYSA-N
SMILESC[Si](C)(C)CCOC(=O)NCCC(=O)O

Computed by PubChem (NCBI)