Products 787618-34-2
CAS 787618-34-2 is the registry number for 2,4,6-Triisopropyl-2'-methoxybiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(2-methoxyphenyl)-1,3,5-tri(propan-2-yl)benzene (CAS 787618-34-2) is a chemical compound with the molecular formula C22H30O and a molecular weight of 310.5 g/mol. IUPAC name: 2-(2-methoxyphenyl)-1,3,5-tri(propan-2-yl)benzene. InChIKey: GFOVVCLICMVFKN-UHFFFAOYSA-N.
| Molecular formula | C22H30O |
|---|---|
| Molecular weight | 310.5 g/mol |
| IUPAC name | 2-(2-methoxyphenyl)-1,3,5-tri(propan-2-yl)benzene |
| InChIKey | GFOVVCLICMVFKN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC=CC=C2OC)C(C)C |
Computed by PubChem (NCBI)