Products 787621-78-7
CAS 787621-78-7 is the registry number for Estrogen receptor modulator 6. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3aS,4R,9bR)-2,2-difluoro-4-(4-hydroxyphenyl)-3,3a,4,9b-tetrahydro-1H-cyclopenta[c]chromen-8-ol (CAS 787621-78-7) is a chemical compound with the molecular formula C18H16F2O3 and a molecular weight of 318.3 g/mol. IUPAC name: (3aS,4R,9bR)-2,2-difluoro-4-(4-hydroxyphenyl)-3,3a,4,9b-tetrahydro-1H-cyclopenta[c]chromen-8-ol. InChIKey: QJSMFUTULGSHNQ-ZOBUZTSGSA-N.
| Molecular formula | C18H16F2O3 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | (3aS,4R,9bR)-2,2-difluoro-4-(4-hydroxyphenyl)-3,3a,4,9b-tetrahydro-1H-cyclopenta[c]chromen-8-ol |
| InChIKey | QJSMFUTULGSHNQ-ZOBUZTSGSA-N |
| SMILES | C1[C@H]2[C@@H](CC1(F)F)C3=C(C=CC(=C3)O)O[C@H]2C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)