Products 78771-34-3
CAS 78771-34-3 appears in our catalog under these names: 3'-O-Methylguanosine-5'-diphosphate, 3′-O-Methylguanosine 5′-(trihydrogen diphosphate), 98%, 98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 100mg, 250mg.
[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 78771-34-3) is a chemical compound with the molecular formula C11H17N5O11P2 and a molecular weight of 457.23 g/mol. IUPAC name: [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: LBHMDBPTFLRYQU-KQYNXXCUSA-N.
| Molecular formula | C11H17N5O11P2 |
|---|---|
| Molecular weight | 457.23 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | LBHMDBPTFLRYQU-KQYNXXCUSA-N |
| SMILES | CO[C@@H]1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)O |
Computed by PubChem (NCBI)