CAS 788136-89-0 appears in our catalog under these names: Gefitinib Impurity 61, 4-((3-Chloro-4-fluorophenyl)amino)-7-methoxyquinazolin-6-yl Acetate, 4–((3–Chloro–4–fluorophenyl)amino)–7–methoxyquinazolin–6–yl acetate, Gefitinib analog III/ 97.6% (existing batch purity), Gefitinib analog III 95%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Ambeed. Available pack sizes: on request, 5mg, 5g, 50mg, 100mg, 250mg, 10g.
[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl] acetate (CAS 788136-89-0) is a chemical compound with the molecular formula C17H13ClFN3O3 and a molecular weight of 361.8 g/mol. IUPAC name: [4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl] acetate. InChIKey: ANGPUOTYQQFHKN-UHFFFAOYSA-N.
| Molecular formula | C17H13ClFN3O3 |
|---|---|
| Molecular weight | 361.8 g/mol |
| IUPAC name | [4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl] acetate |
| InChIKey | ANGPUOTYQQFHKN-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)OC |
Computed by PubChem (NCBI)