CAS 788824-70-4 appears in our catalog under these names: Thyroxamine Impurity 2 HCl, 3,3',5-Triiodothyronamine Hydrochloride, 3,3,5-Triiodothyronamine hydrochloride. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 50mg, 25mg.
4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2-iodophenol;hydrochloride (CAS 788824-70-4) is a chemical compound with the molecular formula C14H13ClI3NO2 and a molecular weight of 643.42 g/mol. IUPAC name: 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2-iodophenol;hydrochloride. InChIKey: KPJJJRQBESKCMT-UHFFFAOYSA-N.
| Molecular formula | C14H13ClI3NO2 |
|---|---|
| Molecular weight | 643.42 g/mol |
| IUPAC name | 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2-iodophenol;hydrochloride |
| InChIKey | KPJJJRQBESKCMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CCN)I)I)O.Cl |
Computed by PubChem (NCBI)