CAS 789-25-3 appears in our catalog under these names: Triphenylsilane, Triphenylsilane, 97% , Triphenylsilane, >96.0%(GC), Triphenylsilane 96%, TRIPHENYLSILANE, 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100mg, 500mg, 50mg, 100g, 25g, 50g, 10g, 5g.
Triphenylsilane (CAS 789-25-3) is a chemical compound with the molecular formula C18H16Si and a molecular weight of 260.4 g/mol. IUPAC name: triphenylsilane. InChIKey: AKQNYQDSIDKVJZ-UHFFFAOYSA-N.
| Molecular formula | C18H16Si |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | triphenylsilane |
| InChIKey | AKQNYQDSIDKVJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[SiH](C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)