CAS 78904-44-6 is the registry number for 1-(2,6-Dimethoxyphenyl)-2-nitropropene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,3-dimethoxy-2-(2-nitroprop-1-enyl)benzene (CAS 78904-44-6) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 1,3-dimethoxy-2-(2-nitroprop-1-enyl)benzene. InChIKey: BTHUWEKTWWOHCT-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 1,3-dimethoxy-2-(2-nitroprop-1-enyl)benzene |
| InChIKey | BTHUWEKTWWOHCT-UHFFFAOYSA-N |
| SMILES | CC(=CC1=C(C=CC=C1OC)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)