CAS 78957-84-3 appears in our catalog under these names: N-(4-Aminobutyl)-5-chloro-1-naphthalenesulfonamide Hydrochloride, >95% (HPLC), N–(4–aminobutyl)–5–chloro–1–naphthalenesulfonamide hydrochloride, Calmodulin antagonist–1, Calmodulin antagonist-1, 98%, 98%, Calmodulin antagonist-1, 98.0%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 250mg, 25mg, 5mg, 10 mg, 5 mg.
N-(4-aminobutyl)-5-chloronaphthalene-1-sulfonamide;hydrochloride (CAS 78957-84-3) is a chemical compound with the molecular formula C14H18Cl2N2O2S and a molecular weight of 349.3 g/mol. IUPAC name: N-(4-aminobutyl)-5-chloronaphthalene-1-sulfonamide;hydrochloride. InChIKey: IKMXJMNRHREPOD-UHFFFAOYSA-N.
| Molecular formula | C14H18Cl2N2O2S |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | N-(4-aminobutyl)-5-chloronaphthalene-1-sulfonamide;hydrochloride |
| InChIKey | IKMXJMNRHREPOD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2Cl)C(=C1)S(=O)(=O)NCCCCN.Cl |
Computed by PubChem (NCBI)