Products 78969-72-9
CAS 78969-72-9 is the registry number for Guanfu base G, 99.91%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
(10,19-diacetyloxy-9-hydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) acetate (CAS 78969-72-9) is a chemical compound with the molecular formula C26H33NO7 and a molecular weight of 471.5 g/mol. IUPAC name: (10,19-diacetyloxy-9-hydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) acetate. InChIKey: CXQAPRGJWIADOG-UHFFFAOYSA-N.
| Molecular formula | C26H33NO7 |
|---|---|
| Molecular weight | 471.5 g/mol |
| IUPAC name | (10,19-diacetyloxy-9-hydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) acetate |
| InChIKey | CXQAPRGJWIADOG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CC2(CN3C4C2C5(C1)C3C6(C(C7C(C5C6(C4)CC7=C)OC(=O)C)OC(=O)C)O)C |
Computed by PubChem (NCBI)
Synonyms:
Guan-fu base G