CAS 78995-98-9 appears in our catalog under these names: Beta-Cyclocitral-d5, Technical Grade, β-Cyclocitral-d5, β-Cyclocitral-d5. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 500mg, 50mg, Get quote.
3,3-dideuterio-6,6-dimethyl-2-(trideuteriomethyl)cyclohexene-1-carbaldehyde (CAS 78995-98-9) is a chemical compound with the molecular formula C10H16O and a molecular weight of 157.26 g/mol. IUPAC name: 3,3-dideuterio-6,6-dimethyl-2-(trideuteriomethyl)cyclohexene-1-carbaldehyde. InChIKey: MOQGCGNUWBPGTQ-RPIBLTHZSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 157.26 g/mol |
| IUPAC name | 3,3-dideuterio-6,6-dimethyl-2-(trideuteriomethyl)cyclohexene-1-carbaldehyde |
| InChIKey | MOQGCGNUWBPGTQ-RPIBLTHZSA-N |
| SMILES | [2H]C1(CCC(C(=C1C([2H])([2H])[2H])C=O)(C)C)[2H] |
Computed by PubChem (NCBI)