CAS 79-51-6 is the registry number for 1,3-Difluorotetrachloroacetone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,1,3,3-tetrachloro-1,3-difluoropropan-2-one (CAS 79-51-6) is a chemical compound with the molecular formula C3Cl4F2O and a molecular weight of 231.8 g/mol. IUPAC name: 1,1,3,3-tetrachloro-1,3-difluoropropan-2-one. InChIKey: MXYOKVCIXGJEFW-UHFFFAOYSA-N.
| Molecular formula | C3Cl4F2O |
|---|---|
| Molecular weight | 231.8 g/mol |
| IUPAC name | 1,1,3,3-tetrachloro-1,3-difluoropropan-2-one |
| InChIKey | MXYOKVCIXGJEFW-UHFFFAOYSA-N |
| SMILES | C(=O)(C(F)(Cl)Cl)C(F)(Cl)Cl |
Computed by PubChem (NCBI)