CAS 79-96-9 appears in our catalog under these names: 4,4'-(Propane-2,2-diyl)bis(2-(tert-butyl)phenol), 97%, 2,2-Bis(4-hydroxy-3-tert-butylphenyl)propane, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 50mg, 100mg.
2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxyphenyl)propan-2-yl]phenol (CAS 79-96-9) is a chemical compound with the molecular formula C23H32O2 and a molecular weight of 340.5 g/mol. IUPAC name: 2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxyphenyl)propan-2-yl]phenol. InChIKey: ZDRSNHRWLQQICP-UHFFFAOYSA-N.
| Molecular formula | C23H32O2 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | 2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxyphenyl)propan-2-yl]phenol |
| InChIKey | ZDRSNHRWLQQICP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)C(C)(C)C2=CC(=C(C=C2)O)C(C)(C)C)O |
Computed by PubChem (NCBI)