CAS 790208-54-7 is the registry number for (R)-6-Fluoro-indan-1-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1R)-6-fluoro-2,3-dihydro-1H-inden-1-amine (CAS 790208-54-7) is a chemical compound with the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. IUPAC name: (1R)-6-fluoro-2,3-dihydro-1H-inden-1-amine. InChIKey: KZXWOWJBKSZXAL-SECBINFHSA-N.
| Molecular formula | C9H10FN |
|---|---|
| Molecular weight | 151.18 g/mol |
| IUPAC name | (1R)-6-fluoro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | KZXWOWJBKSZXAL-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=C(C=C2)F |
Computed by PubChem (NCBI)