CAS 790232-08-5 appears in our catalog under these names: 2-Chloro-n-(2,4-dibromophenyl)propanamide, 95%, N-(2,4-Dibromophenyl)-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g.
2-chloro-N-(2,4-dibromophenyl)propanamide (CAS 790232-08-5) is a chemical compound with the molecular formula C9H8Br2ClNO and a molecular weight of 341.42 g/mol. IUPAC name: 2-chloro-N-(2,4-dibromophenyl)propanamide. InChIKey: WVBWPKIHMJFYEA-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2ClNO |
|---|---|
| Molecular weight | 341.42 g/mol |
| IUPAC name | 2-chloro-N-(2,4-dibromophenyl)propanamide |
| InChIKey | WVBWPKIHMJFYEA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C=C(C=C1)Br)Br)Cl |
Computed by PubChem (NCBI)