Products 790232-13-2
CAS 790232-13-2 appears in our catalog under these names: 2-Chloro-n-mesitylpropanamide, 95%, N-(2,4,6-Trimethylphenyl)-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g.
2-chloro-N-(2,4,6-trimethylphenyl)propanamide (CAS 790232-13-2) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: 2-chloro-N-(2,4,6-trimethylphenyl)propanamide. InChIKey: WKCAZHBXIHNJAB-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | 2-chloro-N-(2,4,6-trimethylphenyl)propanamide |
| InChIKey | WKCAZHBXIHNJAB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)C(C)Cl)C |
Computed by PubChem (NCBI)