CAS 790263-54-6 is the registry number for 4-Chloro-2-(2,3-dihydro-1,3-benzothiazol-2-ylidene)-3-oxopentanenitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(Z)-2-(1,3-benzothiazol-2-yl)-4-chloro-3-hydroxypent-2-enenitrile (CAS 790263-54-6) is a chemical compound with the molecular formula C12H9ClN2OS and a molecular weight of 264.73 g/mol. IUPAC name: (Z)-2-(1,3-benzothiazol-2-yl)-4-chloro-3-hydroxypent-2-enenitrile. InChIKey: UFUVMKZLCHFJTK-FLIBITNWSA-N.
| Molecular formula | C12H9ClN2OS |
|---|---|
| Molecular weight | 264.73 g/mol |
| IUPAC name | (Z)-2-(1,3-benzothiazol-2-yl)-4-chloro-3-hydroxypent-2-enenitrile |
| InChIKey | UFUVMKZLCHFJTK-FLIBITNWSA-N |
| SMILES | CC(/C(=C(\C#N)/C1=NC2=CC=CC=C2S1)/O)Cl |
Computed by PubChem (NCBI)