CAS 790263-74-0 appears in our catalog under these names: 8-Fluoro-4H-thieno(3,2-c)thiochromene-2-carboxylic acid, 95%, 8-Fluoro-4H-thieno(3,2-c)thiochromene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
8-fluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid (CAS 790263-74-0) is a chemical compound with the molecular formula C12H7FO2S2 and a molecular weight of 266.3 g/mol. IUPAC name: 8-fluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid. InChIKey: ABVWPIVEGZQKRM-UHFFFAOYSA-N.
| Molecular formula | C12H7FO2S2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 8-fluoro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid |
| InChIKey | ABVWPIVEGZQKRM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=C(S1)C=CC(=C3)F)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)