CAS 79055-67-7 appears in our catalog under these names: L(+)-2-Amino-5-phosphonovaleric acid, >95% (HPLC), L-AP5, L–AP5, L(+)-2-Amino-5-phosphonovaleric acid. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 10mg, 100mg, 5 mg, 10 mg, 1 mg.
(2S)-2-amino-5-phosphonopentanoic acid (CAS 79055-67-7) is a chemical compound with the molecular formula C5H12NO5P and a molecular weight of 197.13 g/mol. IUPAC name: (2S)-2-amino-5-phosphonopentanoic acid. InChIKey: VOROEQBFPPIACJ-BYPYZUCNSA-N.
| Molecular formula | C5H12NO5P |
|---|---|
| Molecular weight | 197.13 g/mol |
| IUPAC name | (2S)-2-amino-5-phosphonopentanoic acid |
| InChIKey | VOROEQBFPPIACJ-BYPYZUCNSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CP(=O)(O)O |
Computed by PubChem (NCBI)