CAS 79069-51-5 appears in our catalog under these names: Boc-l-valinal, 95%, (S)–tert–Butyl (3–methyl–1–oxobutan–2–yl)carbamate, (S)-tert-Butyl (3-methyl-1-oxobutan-2-yl)carbamate 97%, N-Boc-L-valinal, 97%, 97%, (S)-TERT-BUTYL (3-METHYL-1-OXOBUTAN-2-YL)CARBAMATE, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 100mg.
Tert-butyl N-[(2S)-3-methyl-1-oxobutan-2-yl]carbamate (CAS 79069-51-5) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl N-[(2S)-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: YMNBXYLOSIKZGL-MRVPVSSYSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl N-[(2S)-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | YMNBXYLOSIKZGL-MRVPVSSYSA-N |
| SMILES | CC(C)[C@@H](C=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)