CAS 79094-20-5 appears in our catalog under these names: Daltroban, Daltroban/ 99.49% (existing batch purity), Daltroban, ≥98%(HPLC), ≥98%(HPLC), Daltroban, 98.19%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 1 mg.
2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]acetic acid (CAS 79094-20-5) is a chemical compound with the molecular formula C16H16ClNO4S and a molecular weight of 353.8 g/mol. IUPAC name: 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]acetic acid. InChIKey: IULOBWFWYDMECP-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO4S |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]acetic acid |
| InChIKey | IULOBWFWYDMECP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCNS(=O)(=O)C2=CC=C(C=C2)Cl)CC(=O)O |
Computed by PubChem (NCBI)