CAS 791-50-4 is the registry number for 2,2,4,4-Tetrakis(trifluoromethyl)-1,3-dithietane. Offered by: TRC. Available pack sizes: 2,5g.
2,2,4,4-tetrakis(trifluoromethyl)-1,3-dithietane (CAS 791-50-4) is a chemical compound with the molecular formula C6F12S2 and a molecular weight of 364.2 g/mol. IUPAC name: 2,2,4,4-tetrakis(trifluoromethyl)-1,3-dithietane. InChIKey: QKKBOQYIHOYXKK-UHFFFAOYSA-N.
| Molecular formula | C6F12S2 |
|---|---|
| Molecular weight | 364.2 g/mol |
| IUPAC name | 2,2,4,4-tetrakis(trifluoromethyl)-1,3-dithietane |
| InChIKey | QKKBOQYIHOYXKK-UHFFFAOYSA-N |
| SMILES | C1(SC(S1)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)