CAS 79100-27-9 is the registry number for NSC-217913. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 2-[(5,6-dichloro-1H-imidazo[4,5-b]pyrazin-2-yl)sulfanyl]acetate (CAS 79100-27-9) is a chemical compound with the molecular formula C9H8Cl2N4O2S and a molecular weight of 307.16 g/mol. IUPAC name: ethyl 2-[(5,6-dichloro-1H-imidazo[4,5-b]pyrazin-2-yl)sulfanyl]acetate. InChIKey: IHYIVLYZIUBRHY-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N4O2S |
|---|---|
| Molecular weight | 307.16 g/mol |
| IUPAC name | ethyl 2-[(5,6-dichloro-1H-imidazo[4,5-b]pyrazin-2-yl)sulfanyl]acetate |
| InChIKey | IHYIVLYZIUBRHY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CSC1=NC2=C(N1)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)