CAS 791072-70-3 is the registry number for 4,4',4''-(Benzene-1,3,5-triyltris(ethene-2,1-diyl))trianiline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-2-[3,5-bis[(E)-2-(4-aminophenyl)ethenyl]phenyl]ethenyl]aniline (CAS 791072-70-3) is a chemical compound with the molecular formula C30H27N3 and a molecular weight of 429.6 g/mol. IUPAC name: 4-[(E)-2-[3,5-bis[(E)-2-(4-aminophenyl)ethenyl]phenyl]ethenyl]aniline. InChIKey: UQVATHYOHJVXHT-GZDDRBCLSA-N.
| Molecular formula | C30H27N3 |
|---|---|
| Molecular weight | 429.6 g/mol |
| IUPAC name | 4-[(E)-2-[3,5-bis[(E)-2-(4-aminophenyl)ethenyl]phenyl]ethenyl]aniline |
| InChIKey | UQVATHYOHJVXHT-GZDDRBCLSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)/C=C/C3=CC=C(C=C3)N)/C=C/C4=CC=C(C=C4)N)N |
Computed by PubChem (NCBI)