CAS 492467-75-1 is the registry number for 4,4',4''-(Benzene-1,3,5-triyltris(ethene-2,1-diyl))trianiline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[2-[3,5-bis[2-(4-aminophenyl)ethenyl]phenyl]ethenyl]aniline (CAS 492467-75-1) is a chemical compound with the molecular formula C30H27N3 and a molecular weight of 429.6 g/mol. IUPAC name: 4-[2-[3,5-bis[2-(4-aminophenyl)ethenyl]phenyl]ethenyl]aniline. InChIKey: UQVATHYOHJVXHT-UHFFFAOYSA-N.
| Molecular formula | C30H27N3 |
|---|---|
| Molecular weight | 429.6 g/mol |
| IUPAC name | 4-[2-[3,5-bis[2-(4-aminophenyl)ethenyl]phenyl]ethenyl]aniline |
| InChIKey | UQVATHYOHJVXHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)C=CC3=CC=C(C=C3)N)C=CC4=CC=C(C=C4)N)N |
Computed by PubChem (NCBI)