CAS 79128-68-0 appears in our catalog under these names: Methyl 3-(2,2,2-trifluoroacetamido)thiophene-2-carboxylate, 97%, 97%, 3-(2,2,2-Trifluoro-acetylamino)-thiophene-2-carboxylic acid methyl ester, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
Methyl 3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylate (CAS 79128-68-0) is a chemical compound with the molecular formula C8H6F3NO3S and a molecular weight of 253.20 g/mol. IUPAC name: methyl 3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylate. InChIKey: CJNCTQZMIQZVQQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3S |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | methyl 3-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylate |
| InChIKey | CJNCTQZMIQZVQQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)