CAS 79157-36-1 is the registry number for Latinone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
7-hydroxy-3,6-dimethoxy-9-phenylphenanthrene-1,4-dione (CAS 79157-36-1) is a chemical compound with the molecular formula C22H16O5 and a molecular weight of 360.4 g/mol. IUPAC name: 7-hydroxy-3,6-dimethoxy-9-phenylphenanthrene-1,4-dione. InChIKey: WAAZBXYZFBGWND-UHFFFAOYSA-N.
| Molecular formula | C22H16O5 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 7-hydroxy-3,6-dimethoxy-9-phenylphenanthrene-1,4-dione |
| InChIKey | WAAZBXYZFBGWND-UHFFFAOYSA-N |
| SMILES | COC1=CC(=O)C2=C(C1=O)C3=CC(=C(C=C3C(=C2)C4=CC=CC=C4)O)OC |
Computed by PubChem (NCBI)