CAS 79175-35-2 appears in our catalog under these names: 3,4–DichlorophenylMagnesiuM broMide, 3,4-Dichlorophenylmagnesium bromide - 0.5M solution in tetrahydrofuran, 3,4-DICHLOROPHENYLMAGNESIUM BROMIDE, 0.&. Offered by: GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 50ml, 100g.
Magnesium;1,2-dichlorobenzene-5-ide;bromide (CAS 79175-35-2) is a chemical compound with the molecular formula C6H3BrCl2Mg and a molecular weight of 250.20 g/mol. IUPAC name: magnesium;1,2-dichlorobenzene-5-ide;bromide. InChIKey: RMXGWLUCCKWPGK-UHFFFAOYSA-M.
| Molecular formula | C6H3BrCl2Mg |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | magnesium;1,2-dichlorobenzene-5-ide;bromide |
| InChIKey | RMXGWLUCCKWPGK-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=[C-]1)Cl)Cl.[Mg+2].[Br-] |
Computed by PubChem (NCBI)