Products 791793-62-9

CAS 791793-62-9 is the registry number for 2-((4-(N-Methyl-N-phenylsulfamoyl)phenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid (CAS 791793-62-9) is a chemical compound with the molecular formula C21H18N2O5S and a molecular weight of 410.4 g/mol. IUPAC name: 2-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid. InChIKey: WIZBPXGDKQWWOQ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18N2O5S
Molecular weight410.4 g/mol
IUPAC name2-[[4-[methyl(phenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid
InChIKeyWIZBPXGDKQWWOQ-UHFFFAOYSA-N
SMILESCN(C1=CC=CC=C1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)