CAS 791848-71-0 is the registry number for ANEB-001, 99.73%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 25 mg, 5 mg.
N-tert-butyl-3-[(R)-(4-chlorophenyl)-[2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide (CAS 791848-71-0) is a chemical compound with the molecular formula C22H24ClF3N2O2 and a molecular weight of 440.9 g/mol. IUPAC name: N-tert-butyl-3-[(R)-(4-chlorophenyl)-[2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide. InChIKey: BNLYOVHLLDBOFZ-LJQANCHMSA-N.
| Molecular formula | C22H24ClF3N2O2 |
|---|---|
| Molecular weight | 440.9 g/mol |
| IUPAC name | N-tert-butyl-3-[(R)-(4-chlorophenyl)-[2-(trifluoromethyl)phenyl]methoxy]azetidine-1-carboxamide |
| InChIKey | BNLYOVHLLDBOFZ-LJQANCHMSA-N |
| SMILES | CC(C)(C)NC(=O)N1CC(C1)O[C@H](C2=CC=C(C=C2)Cl)C3=CC=CC=C3C(F)(F)F |
Computed by PubChem (NCBI)