CAS 792184-90-8 appears in our catalog under these names: ASP2905, 98%, ASP2905, ASP2905/ 98.29% (existing batch purity), ASP2905 99%, N2-(4-Fluorophenyl)-N4-phenyl-N6-(pyrimidin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine, 98%, 98%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 100mg, 25mg, 50mg, 200mg, 250mg.
2-N-(4-fluorophenyl)-4-N-phenyl-6-N-(pyrimidin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine (CAS 792184-90-8) is a chemical compound with the molecular formula C20H17FN8 and a molecular weight of 388.4 g/mol. IUPAC name: 2-N-(4-fluorophenyl)-4-N-phenyl-6-N-(pyrimidin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine. InChIKey: APYUZVKHUKMAIJ-UHFFFAOYSA-N.
| Molecular formula | C20H17FN8 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 2-N-(4-fluorophenyl)-4-N-phenyl-6-N-(pyrimidin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| InChIKey | APYUZVKHUKMAIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)NCC3=NC=CC=N3)NC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)