CAS 79222-05-2 is the registry number for N-(4,5,6,7-Tetrahydro-1-benzothiophen-4-ylidene)hydroxylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NZ)-N-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine (CAS 79222-05-2) is a chemical compound with the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. IUPAC name: (NZ)-N-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine. InChIKey: JMHKHQOLEYGCNT-CLFYSBASSA-N.
| Molecular formula | C8H9NOS |
|---|---|
| Molecular weight | 167.23 g/mol |
| IUPAC name | (NZ)-N-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine |
| InChIKey | JMHKHQOLEYGCNT-CLFYSBASSA-N |
| SMILES | C1CC2=C(C=CS2)/C(=N\O)/C1 |
Computed by PubChem (NCBI)