CAS 79265-34-2 is the registry number for 2,5-Bis(trimethylsilyl)thiazole, 95%. Offered by: AmBeed. Available pack sizes: 10g.
Trimethyl-(2-trimethylsilyl-1,3-thiazol-5-yl)silane (CAS 79265-34-2) is a chemical compound with the molecular formula C9H19NSSi2 and a molecular weight of 229.49 g/mol. IUPAC name: trimethyl-(2-trimethylsilyl-1,3-thiazol-5-yl)silane. InChIKey: RZHDOWFVGMFXMC-UHFFFAOYSA-N.
| Molecular formula | C9H19NSSi2 |
|---|---|
| Molecular weight | 229.49 g/mol |
| IUPAC name | trimethyl-(2-trimethylsilyl-1,3-thiazol-5-yl)silane |
| InChIKey | RZHDOWFVGMFXMC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CN=C(S1)[Si](C)(C)C |
Computed by PubChem (NCBI)