CAS 79278-40-3 is the registry number for rac-cis-1-benzyl-2-methyl-4-(N-propananilido)piperidine. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg.
N-[(3S,4R)-1-benzyl-3-methylpiperidin-4-yl]-N-phenylpropanamide (CAS 79278-40-3) is a chemical compound with the molecular formula C22H28N2O and a molecular weight of 336.5 g/mol. IUPAC name: N-[(3S,4R)-1-benzyl-3-methylpiperidin-4-yl]-N-phenylpropanamide. InChIKey: MSAFCEWTMBDBFQ-GHTZIAJQSA-N.
| Molecular formula | C22H28N2O |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | N-[(3S,4R)-1-benzyl-3-methylpiperidin-4-yl]-N-phenylpropanamide |
| InChIKey | MSAFCEWTMBDBFQ-GHTZIAJQSA-N |
| SMILES | CCC(=O)N([C@@H]1CCN(C[C@@H]1C)CC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)