CAS 79288-94-1 appears in our catalog under these names: Azure b tetrafluoroborate, 95%, Azure B Tetrafluoroborate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.
Dimethyl-[7-(methylamino)phenothiazin-3-ylidene]azanium tetrafluoroborate (CAS 79288-94-1) is a chemical compound with the molecular formula C15H16BF4N3S and a molecular weight of 357.2 g/mol. IUPAC name: dimethyl-[7-(methylamino)phenothiazin-3-ylidene]azanium tetrafluoroborate. InChIKey: OYVZJZSEBPXXFF-UHFFFAOYSA-O.
| Molecular formula | C15H16BF4N3S |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | dimethyl-[7-(methylamino)phenothiazin-3-ylidene]azanium tetrafluoroborate |
| InChIKey | OYVZJZSEBPXXFF-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CNC1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2 |
Computed by PubChem (NCBI)