CAS 792913-45-2 is the registry number for 2-(3-Bromophenyl)-4,5-dihydro-1,3-oxazole, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(3-bromophenyl)-4,5-dihydro-1,3-oxazole (CAS 792913-45-2) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 2-(3-bromophenyl)-4,5-dihydro-1,3-oxazole. InChIKey: SJJQTHCDSIMQGE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 2-(3-bromophenyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | SJJQTHCDSIMQGE-UHFFFAOYSA-N |
| SMILES | C1COC(=N1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)