CAS 792952-65-9 is the registry number for 1,2-Bis(5-bromo-2-chlorophenyl)disulfane, 97%. Offered by: AmBeed. Available pack sizes: 25g.
4-bromo-2-[(5-bromo-2-chlorophenyl)disulfanyl]-1-chlorobenzene (CAS 792952-65-9) is a chemical compound with the molecular formula C12H6Br2Cl2S2 and a molecular weight of 445.0 g/mol. IUPAC name: 4-bromo-2-[(5-bromo-2-chlorophenyl)disulfanyl]-1-chlorobenzene. InChIKey: LXVBPLSCYANPQH-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2Cl2S2 |
|---|---|
| Molecular weight | 445.0 g/mol |
| IUPAC name | 4-bromo-2-[(5-bromo-2-chlorophenyl)disulfanyl]-1-chlorobenzene |
| InChIKey | LXVBPLSCYANPQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)SSC2=C(C=CC(=C2)Br)Cl)Cl |
Computed by PubChem (NCBI)